C29H38N2O4P+ — CID 160620295
butyl(oxo)phosphanium;3-[(2,6-dimethoxyphenyl)-phenylmethyl]-2,4,6-trimethylbenzohydrazide (PubChem CID 160620295) has the molecular formula C29H38N2O4P+ and a molecular weight of 509.61 g/mol. Its IUPAC name is butyl(oxo)phosphanium;3-[(2,6-dimethoxyphenyl)-phenylmethyl]-2,4,6-trimethylbenzohydrazide.
| Compound Name | butyl(oxo)phosphanium;3-[(2,6-dimethoxyphenyl)-phenylmethyl]-2,4,6-trimethylbenzohydrazide |
|---|---|
| PubChem CID | 160620295 |
| Molecular Formula | C29H38N2O4P+ |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | butyl(oxo)phosphanium;3-[(2,6-dimethoxyphenyl)-phenylmethyl]-2,4,6-trimethylbenzohydrazide |
| SMILES | CCCC[PH+]=O.COc1cccc(OC)c1C(c1ccccc1)c1c(C)cc(C)c(C(=O)NN)c1C |
| InChI | InChI=1S/C25H28N2O3.C4H9OP/c1-15-14-16(2)22(25(28)27-26)17(3)21(15)23(18-10-7-6-8-11-18)24-19(29-4)12-9-13-20(24)30-5;1-2-3-4-6-5/h6-14,23H,26H2,1-5H3,(H,27,28);2-4H2,1H3/p+1 |
| InChIKey | RGPSHOJKXIEKQD-UHFFFAOYSA-O |
| XLogP | 6.22 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|