C12H18ClNO4 — CID 121002575
ethyl 2-amino-2-(2,6-dimethoxyphenyl)acetate;hydrochloride (PubChem CID 121002575) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is ethyl 2-amino-2-(2,6-dimethoxyphenyl)acetate;hydrochloride.
| Compound Name | ethyl 2-amino-2-(2,6-dimethoxyphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 121002575 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethyl 2-amino-2-(2,6-dimethoxyphenyl)acetate;hydrochloride |
| SMILES | CCOC(=O)C(N)c1c(OC)cccc1OC.Cl |
| InChI | InChI=1S/C12H17NO4.ClH/c1-4-17-12(14)11(13)10-8(15-2)6-5-7-9(10)16-3;/h5-7,11H,4,13H2,1-3H3;1H |
| InChIKey | MKAPQYCYWZDGBW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |