C15H23NO4 — CID 129395371
ethyl (2S,4S)-4-amino-4-(2,6-dimethoxyphenyl)-2-methylbutanoate (PubChem CID 129395371) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is ethyl (2S,4S)-4-amino-4-(2,6-dimethoxyphenyl)-2-methylbutanoate.
| Compound Name | ethyl (2S,4S)-4-amino-4-(2,6-dimethoxyphenyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 129395371 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | ethyl (2S,4S)-4-amino-4-(2,6-dimethoxyphenyl)-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)C[C@H](N)c1c(OC)cccc1OC |
| InChI | InChI=1S/C15H23NO4/c1-5-20-15(17)10(2)9-11(16)14-12(18-3)7-6-8-13(14)19-4/h6-8,10-11H,5,9,16H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | DDXVDPMWBLARCZ-QWRGUYRKSA-N |
| XLogP | 2.29 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |