C14H18O5 — CID 134333241
ethyl 4-(1-ethoxyethenyl)-3,6-dihydroxy-2-methylbenzoate (PubChem CID 134333241) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl 4-(1-ethoxyethenyl)-3,6-dihydroxy-2-methylbenzoate.
| Compound Name | ethyl 4-(1-ethoxyethenyl)-3,6-dihydroxy-2-methylbenzoate |
|---|---|
| PubChem CID | 134333241 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl 4-(1-ethoxyethenyl)-3,6-dihydroxy-2-methylbenzoate |
| SMILES | C=C(OCC)c1cc(O)c(C(=O)OCC)c(C)c1O |
| InChI | InChI=1S/C14H18O5/c1-5-18-9(4)10-7-11(15)12(8(3)13(10)16)14(17)19-6-2/h7,15-16H,4-6H2,1-3H3 |
| InChIKey | LRGPQGDMELRUIF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|