C41H63N5O11Si2 — CID 100959682
2-[4-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-N-[2-(3-triethoxysilylpropylcarbamoyloxy)ethyl]anilino]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 100959682) has the molecular formula C41H63N5O11Si2 and a molecular weight of 858.15 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-N-[2-(3-triethoxysilylpropylcarbamoyloxy)ethyl]anilino]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[4-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-N-[2-(3-triethoxysilylpropylcarbamoyloxy)ethyl]anilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 100959682 |
| Molecular Formula | C41H63N5O11Si2 |
| Molecular Weight | 858.15 g/mol |
| Exact Mass | 857.41 |
| IUPAC Name | 2-[4-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]-N-[2-(3-triethoxysilylpropylcarbamoyloxy)ethyl]anilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCN(CCOC(=O)NCCC[Si](OCC)(OCC)OCC)c1ccc(/C=C/C2=CC(=C(C#N)C#N)C=C(C)O2)cc1)(OCC)OCC |
| InChI | InChI=1S/C41H63N5O11Si2/c1-8-51-58(52-9-2,53-10-3)28-14-22-44-40(47)49-26-24-46(25-27-50-41(48)45-23-15-29-59(54-11-4,55-12-5)56-13-6)38-19-16-35(17-20-38)18-21-39-31-36(30-34(7)57-39)37(32-42)33-43/h16-21,30-31H,8-15,22-29H2,1-7H3,(H,44,47)(H,45,48)/b21-18+ |
| InChIKey | ZNNKBEFUDSPJJO-DYTRJAOYSA-N |
| XLogP | 7.00 |
| TPSA | 192.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.15 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|