C29H56N4O7Si2 — CID 157470777
ethane;2-(N-ethyl-4-nitrosoanilino)ethyl N-(3-triethoxysilylpropyl)carbamate;3-isocyanatopropyl(trimethyl)silane (PubChem CID 157470777) has the molecular formula C29H56N4O7Si2 and a molecular weight of 628.96 g/mol. Its IUPAC name is ethane;2-(N-ethyl-4-nitrosoanilino)ethyl N-(3-triethoxysilylpropyl)carbamate;3-isocyanatopropyl(trimethyl)silane.
| Compound Name | ethane;2-(N-ethyl-4-nitrosoanilino)ethyl N-(3-triethoxysilylpropyl)carbamate;3-isocyanatopropyl(trimethyl)silane |
|---|---|
| PubChem CID | 157470777 |
| Molecular Formula | C29H56N4O7Si2 |
| Molecular Weight | 628.96 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | ethane;2-(N-ethyl-4-nitrosoanilino)ethyl N-(3-triethoxysilylpropyl)carbamate;3-isocyanatopropyl(trimethyl)silane |
| SMILES | CC.CCO[Si](CCCNC(=O)OCCN(CC)c1ccc(N=O)cc1)(OCC)OCC.C[Si](C)(C)CCCN=C=O |
| InChI | InChI=1S/C20H35N3O6Si.C7H15NOSi.C2H6/c1-5-23(19-12-10-18(22-25)11-13-19)15-16-26-20(24)21-14-9-17-30(27-6-2,28-7-3)29-8-4;1-10(2,3)6-4-5-8-7-9;1-2/h10-13H,5-9,14-17H2,1-4H3,(H,21,24);4-6H2,1-3H3;1-2H3 |
| InChIKey | BUZVOJTVPJVBPB-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.96 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|