C25H36N8O5Si — CID 136901798
2-[4-[(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-N-ethylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 136901798) has the molecular formula C25H36N8O5Si and a molecular weight of 556.70 g/mol. Its IUPAC name is 2-[4-[(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-N-ethylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[4-[(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-N-ethylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 136901798 |
| Molecular Formula | C25H36N8O5Si |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 2-[4-[(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-N-ethylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCN(CC)c1ccc(/N=N/c2nc(C#N)c(C#N)[nH]2)cc1)(OCC)OCC |
| InChI | InChI=1S/C25H36N8O5Si/c1-5-33(15-16-35-25(34)28-14-9-17-39(36-6-2,37-7-3)38-8-4)21-12-10-20(11-13-21)31-32-24-29-22(18-26)23(19-27)30-24/h10-13H,5-9,14-17H2,1-4H3,(H,28,34)(H,29,30)/b32-31+ |
| InChIKey | PUZPQWXSOXGSJS-QNEJGDQOSA-N |
| XLogP | 4.56 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|