C31H50N4O7SSi — CID 90766428
2-[4-[(4-hexylsulfonylphenyl)diazenyl]-N-methylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 90766428) has the molecular formula C31H50N4O7SSi and a molecular weight of 650.92 g/mol. Its IUPAC name is 2-[4-[(4-hexylsulfonylphenyl)diazenyl]-N-methylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[4-[(4-hexylsulfonylphenyl)diazenyl]-N-methylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 90766428 |
| Molecular Formula | C31H50N4O7SSi |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 2-[4-[(4-hexylsulfonylphenyl)diazenyl]-N-methylanilino]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCCCCCS(=O)(=O)c1ccc(/N=N/c2ccc(N(C)CCOC(=O)NCCC[Si](OCC)(OCC)OCC)cc2)cc1 |
| InChI | InChI=1S/C31H50N4O7SSi/c1-6-10-11-12-25-43(37,38)30-20-16-28(17-21-30)34-33-27-14-18-29(19-15-27)35(5)23-24-39-31(36)32-22-13-26-44(40-7-2,41-8-3)42-9-4/h14-21H,6-13,22-26H2,1-5H3,(H,32,36)/b34-33+ |
| InChIKey | OIOGMMFBVXYTAX-JEIPZWNWSA-N |
| XLogP | 7.06 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|