C36H29N3OS — CID 58596370
(2Z)-2-[2-tert-butyl-6-[(E)-2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 58596370) has the molecular formula C36H29N3OS and a molecular weight of 551.72 g/mol. Its IUPAC name is (2Z)-2-[2-tert-butyl-6-[(E)-2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-tert-butyl-6-[(E)-2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58596370 |
| Molecular Formula | C36H29N3OS |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | (2Z)-2-[2-tert-butyl-6-[(E)-2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(/C=C/c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)s2)OC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C36H29N3OS/c1-36(2,3)35-24-27(33(25-37)38-4)23-31(40-35)19-20-32-21-22-34(41-32)26-15-17-30(18-16-26)39(28-11-7-5-8-12-28)29-13-9-6-10-14-29/h5-24H,1-3H3/b20-19+,33-27- |
| InChIKey | KOHLNWGRTWCRCF-CVNBAGKISA-N |
| XLogP | 10.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|