C55H42N4O2 — CID 89435873
(2E)-2-[3-[(E)-2-[4-(4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetic acid (PubChem CID 89435873) has the molecular formula C55H42N4O2 and a molecular weight of 790.97 g/mol. Its IUPAC name is (2E)-2-[3-[(E)-2-[4-(4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetic acid.
| Compound Name | (2E)-2-[3-[(E)-2-[4-(4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetic acid |
|---|---|
| PubChem CID | 89435873 |
| Molecular Formula | C55H42N4O2 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 790.33 |
| IUPAC Name | (2E)-2-[3-[(E)-2-[4-(4-carbazol-9-yl-N-(4-carbazol-9-ylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-2-cyanoacetic acid |
| SMILES | CC1(C)CC(/C=C/c2ccc(N(c3ccc(-n4c5ccccc5c5ccccc54)cc3)c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc2)=C/C(=C(\C#N)C(=O)O)C1 |
| InChI | InChI=1S/C55H42N4O2/c1-55(2)34-38(33-39(35-55)49(36-56)54(60)61)20-19-37-21-23-40(24-22-37)57(41-25-29-43(30-26-41)58-50-15-7-3-11-45(50)46-12-4-8-16-51(46)58)42-27-31-44(32-28-42)59-52-17-9-5-13-47(52)48-14-6-10-18-53(48)59/h3-33H,34-35H2,1-2H3,(H,60,61)/b20-19+,49-39- |
| InChIKey | SAWIFHKLCDKQHJ-LHNKSHTISA-N |
| XLogP | 14.01 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|