C37H36N2O4 — CID 139577747
2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dipropylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 139577747) has the molecular formula C37H36N2O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dipropylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dipropylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139577747 |
| Molecular Formula | C37H36N2O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 2-cyano-3-[4-[(E)-2-[4-[(E)-2-[7-(dipropylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCN(CCC)c1ccc2c(CC)c(/C=C/c3ccc(/C=C/c4ccc(C=C(C#N)C(=O)O)cc4)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C37H36N2O4/c1-4-21-39(22-5-2)31-18-20-33-32(6-3)34(37(42)43-35(33)24-31)19-17-28-11-9-26(10-12-28)7-8-27-13-15-29(16-14-27)23-30(25-38)36(40)41/h7-20,23-24H,4-6,21-22H2,1-3H3,(H,40,41)/b8-7+,19-17+,30-23? |
| InChIKey | STVLPIXZCYSXIU-WSVIXRPPSA-N |
| XLogP | 8.31 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|