C24H22N2O4S — CID 175355450
(E)-2-cyano-3-[7-(diethylamino)-4-(4-methylphenyl)sulfanyl-2-oxochromen-3-yl]prop-2-enoic acid (PubChem CID 175355450) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is (E)-2-cyano-3-[7-(diethylamino)-4-(4-methylphenyl)sulfanyl-2-oxochromen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[7-(diethylamino)-4-(4-methylphenyl)sulfanyl-2-oxochromen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175355450 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (E)-2-cyano-3-[7-(diethylamino)-4-(4-methylphenyl)sulfanyl-2-oxochromen-3-yl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc2c(Sc3ccc(C)cc3)c(/C=C(\C#N)C(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C24H22N2O4S/c1-4-26(5-2)17-8-11-19-21(13-17)30-24(29)20(12-16(14-25)23(27)28)22(19)31-18-9-6-15(3)7-10-18/h6-13H,4-5H2,1-3H3,(H,27,28)/b16-12+ |
| InChIKey | UPPRCHZWWOUODJ-FOWTUZBSSA-N |
| XLogP | 5.09 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|