C39H36N6 — CID 101132247
2,4,6-tris[(E)-2-[4-(dimethylamino)phenyl]ethenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 101132247) has the molecular formula C39H36N6 and a molecular weight of 588.76 g/mol. Its IUPAC name is 2,4,6-tris[(E)-2-[4-(dimethylamino)phenyl]ethenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-tris[(E)-2-[4-(dimethylamino)phenyl]ethenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 101132247 |
| Molecular Formula | C39H36N6 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 2,4,6-tris[(E)-2-[4-(dimethylamino)phenyl]ethenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | CN(C)c1ccc(/C=C/c2c(C#N)c(/C=C/c3ccc(N(C)C)cc3)c(C#N)c(/C=C/c3ccc(N(C)C)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C39H36N6/c1-43(2)31-16-7-28(8-17-31)13-22-34-37(25-40)35(23-14-29-9-18-32(19-10-29)44(3)4)39(27-42)36(38(34)26-41)24-15-30-11-20-33(21-12-30)45(5)6/h7-24H,1-6H3/b22-13+,23-14+,24-15+ |
| InChIKey | VCHFUIFCLFNYKP-ALOUCKEBSA-N |
| XLogP | 8.01 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|