C13H13N3 — CID 151230311
2-[2-[4-(dimethylamino)phenyl]ethenyl]propanedinitrile (PubChem CID 151230311) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]ethenyl]propanedinitrile.
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]propanedinitrile |
|---|---|
| PubChem CID | 151230311 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]propanedinitrile |
| SMILES | CN(C)c1ccc(C=CC(C#N)C#N)cc1 |
| InChI | InChI=1S/C13H13N3/c1-16(2)13-7-5-11(6-8-13)3-4-12(9-14)10-15/h3-8,12H,1-2H3 |
| InChIKey | NODINWKDRCEPQT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|