C13H19NO2 — CID 101464618
4-[(E)-3,3-dimethoxyprop-1-enyl]-N,N-dimethylaniline (PubChem CID 101464618) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-[(E)-3,3-dimethoxyprop-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-3,3-dimethoxyprop-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101464618 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-[(E)-3,3-dimethoxyprop-1-enyl]-N,N-dimethylaniline |
| SMILES | COC(/C=C/c1ccc(N(C)C)cc1)OC |
| InChI | InChI=1S/C13H19NO2/c1-14(2)12-8-5-11(6-9-12)7-10-13(15-3)16-4/h5-10,13H,1-4H3/b10-7+ |
| InChIKey | LNTWYDOZHPJKFK-JXMROGBWSA-N |
| XLogP | 2.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|