C22H34N2O3 — CID 173051232
2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid;N,N-dibutylbutan-1-amine (PubChem CID 173051232) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid;N,N-dibutylbutan-1-amine.
| Compound Name | 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid;N,N-dibutylbutan-1-amine |
|---|---|
| PubChem CID | 173051232 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid;N,N-dibutylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCC.N#CC(=Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H27N.C10H7NO3/c1-4-7-10-13(11-8-5-2)12-9-6-3;11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h4-12H2,1-3H3;1-5,12H,(H,13,14) |
| InChIKey | YSUWOKOLXXGQLM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|