C50H50N2O4S2 — CID 177424882
(Z)-2-cyano-3-[4-[9,9-dihexyl-7-(N-phenylanilino)fluoren-2-yl]-2-ethoxycarbonylthieno[2,3-c]thiophen-6-yl]prop-2-enoic acid (PubChem CID 177424882) has the molecular formula C50H50N2O4S2 and a molecular weight of 807.09 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[9,9-dihexyl-7-(N-phenylanilino)fluoren-2-yl]-2-ethoxycarbonylthieno[2,3-c]thiophen-6-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[9,9-dihexyl-7-(N-phenylanilino)fluoren-2-yl]-2-ethoxycarbonylthieno[2,3-c]thiophen-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177424882 |
| Molecular Formula | C50H50N2O4S2 |
| Molecular Weight | 807.09 g/mol |
| Exact Mass | 806.32 |
| IUPAC Name | (Z)-2-cyano-3-[4-[9,9-dihexyl-7-(N-phenylanilino)fluoren-2-yl]-2-ethoxycarbonylthieno[2,3-c]thiophen-6-yl]prop-2-enoic acid |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3sc(/C=C(/C#N)C(=O)O)c4sc(C(=O)OCC)cc34)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C50H50N2O4S2/c1-4-7-9-17-27-50(28-18-10-8-5-2)42-29-34(46-41-32-45(49(55)56-6-3)58-47(41)44(57-46)30-35(33-51)48(53)54)23-25-39(42)40-26-24-38(31-43(40)50)52(36-19-13-11-14-20-36)37-21-15-12-16-22-37/h11-16,19-26,29-32H,4-10,17-18,27-28H2,1-3H3,(H,53,54)/b35-30- |
| InChIKey | ZIKTVFPMZKVZRJ-GXVXDJONSA-N |
| XLogP | 14.48 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.09 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|