C73H80N2O4V — CID 157127023
ethyl 3-(N-[4-[4-[N-(3-ethoxycarbonylphenyl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)anilino]phenyl]phenyl]-4-methylanilino)benzoate;vanadium (PubChem CID 157127023) has the molecular formula C73H80N2O4V and a molecular weight of 1100.40 g/mol. Its IUPAC name is ethyl 3-(N-[4-[4-[N-(3-ethoxycarbonylphenyl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)anilino]phenyl]phenyl]-4-methylanilino)benzoate;vanadium.
| Compound Name | ethyl 3-(N-[4-[4-[N-(3-ethoxycarbonylphenyl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)anilino]phenyl]phenyl]-4-methylanilino)benzoate;vanadium |
|---|---|
| PubChem CID | 157127023 |
| Molecular Formula | C73H80N2O4V |
| Molecular Weight | 1100.40 g/mol |
| Exact Mass | 1099.56 |
| IUPAC Name | ethyl 3-(N-[4-[4-[N-(3-ethoxycarbonylphenyl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)anilino]phenyl]phenyl]-4-methylanilino)benzoate;vanadium |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(N(c4ccc(-c5ccc(N(c6ccc(C)cc6)c6cccc(C(=O)OCC)c6)cc5)cc4)c4cccc(C(=O)OCC)c4)cc3)cc21.[V] |
| InChI | InChI=1S/C73H80N2O4.V/c1-7-11-13-15-17-19-47-73(48-20-18-16-14-12-8-2)69-49-54(6)29-45-67(69)68-46-36-58(52-70(68)73)57-34-43-64(44-35-57)75(66-26-22-24-60(51-66)72(77)79-10-4)63-41-32-56(33-42-63)55-30-39-62(40-31-55)74(61-37-27-53(5)28-38-61)65-25-21-23-59(50-65)71(76)78-9-3;/h21-46,49-52H,7-20,47-48H2,1-6H3; |
| InChIKey | AIPVULKNCPWFSM-UHFFFAOYSA-N |
| XLogP | 20.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1100.40 |
| LogP ≤ 5 | 20.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|