C42H39N3O4S2 — CID 157247950
(Z)-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 157247950) has the molecular formula C42H39N3O4S2 and a molecular weight of 713.93 g/mol. Its IUPAC name is (Z)-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 157247950 |
| Molecular Formula | C42H39N3O4S2 |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.24 |
| IUPAC Name | (Z)-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1cc2sc(-c3ccc(/C=C/c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)n3CCCCCC)cc2s1)C(=O)O |
| InChI | InChI=1S/C42H39N3O4S2/c1-5-6-7-8-25-44-30(19-24-38(44)39-28-41-40(51-39)27-36(50-41)26-37(43-2)42(46)47)12-9-29-10-13-31(14-11-29)45(32-15-20-34(48-3)21-16-32)33-17-22-35(49-4)23-18-33/h9-24,26-28H,5-8,25H2,1,3-4H3,(H,46,47)/b12-9+,37-26- |
| InChIKey | AVZVMBCFKOSZCW-NPPDAHATSA-N |
| XLogP | 12.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|