C50H56N6O4 — CID 158521077
(Z)-3-[2-(2-ethylhexyl)-7-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]benzotriazol-4-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 158521077) has the molecular formula C50H56N6O4 and a molecular weight of 805.04 g/mol. Its IUPAC name is (Z)-3-[2-(2-ethylhexyl)-7-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]benzotriazol-4-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[2-(2-ethylhexyl)-7-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]benzotriazol-4-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 158521077 |
| Molecular Formula | C50H56N6O4 |
| Molecular Weight | 805.04 g/mol |
| Exact Mass | 804.44 |
| IUPAC Name | (Z)-3-[2-(2-ethylhexyl)-7-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]benzotriazol-4-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)n2CCCCCC)c2nn(CC(CC)CCCC)nc12)C(=O)O |
| InChI | InChI=1S/C50H56N6O4/c1-7-10-12-13-33-54-39(19-15-37-16-20-40(21-17-37)56(41-22-27-43(59-5)28-23-41)42-24-29-44(60-6)30-25-42)26-32-47(54)45-31-18-38(34-46(51-4)50(57)58)48-49(45)53-55(52-48)35-36(9-3)14-11-8-2/h15-32,34,36H,7-14,33,35H2,1-3,5-6H3,(H,57,58)/b19-15+,46-34- |
| InChIKey | HMFJKMMDMWGLNZ-OUYLKALISA-N |
| XLogP | 12.70 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.04 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|