C42H41N3O4 — CID 161190800
(Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]phenyl]-2-isocyanoprop-2-enoic acid (PubChem CID 161190800) has the molecular formula C42H41N3O4 and a molecular weight of 651.81 g/mol. Its IUPAC name is (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]phenyl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]phenyl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 161190800 |
| Molecular Formula | C42H41N3O4 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]phenyl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)n2CCCCCC)cc1)C(=O)O |
| InChI | InChI=1S/C42H41N3O4/c1-5-6-7-8-29-44-34(23-28-41(44)33-14-9-32(10-15-33)30-40(43-2)42(46)47)16-11-31-12-17-35(18-13-31)45(36-19-24-38(48-3)25-20-36)37-21-26-39(49-4)27-22-37/h9-28,30H,5-8,29H2,1,3-4H3,(H,46,47)/b16-11+,40-30- |
| InChIKey | UTRRSYXYQGCZFC-APWWDVIUSA-N |
| XLogP | 10.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|