C50H36N4O6S — CID 153315232
(E)-3-[4-[4-[(Z)-2-carboxy-2-isocyanoethenyl]-N-[4-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]phenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 153315232) has the molecular formula C50H36N4O6S and a molecular weight of 820.93 g/mol. Its IUPAC name is (E)-3-[4-[4-[(Z)-2-carboxy-2-isocyanoethenyl]-N-[4-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]phenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[(Z)-2-carboxy-2-isocyanoethenyl]-N-[4-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]phenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 153315232 |
| Molecular Formula | C50H36N4O6S |
| Molecular Weight | 820.93 g/mol |
| Exact Mass | 820.24 |
| IUPAC Name | (E)-3-[4-[4-[(Z)-2-carboxy-2-isocyanoethenyl]-N-[4-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]phenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C\c1ccc(N(c2ccc(/C=C(\C#N)C(=O)O)cc2)c2ccc(-c3ccc(-c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)s3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C50H36N4O6S/c1-52-46(50(57)58)31-34-6-14-39(15-7-34)53(38-12-4-33(5-13-38)30-37(32-51)49(55)56)40-16-8-35(9-17-40)47-28-29-48(61-47)36-10-18-41(19-11-36)54(42-20-24-44(59-2)25-21-42)43-22-26-45(60-3)27-23-43/h4-31H,2-3H3,(H,55,56)(H,57,58)/b37-30+,46-31- |
| InChIKey | XNUGNGCAYYGGKV-RGGGUDJMSA-N |
| XLogP | 12.38 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.93 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|