C32H25N3O5S2 — CID 102288220
(E)-2-cyano-3-[5-[4-methoxy-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1,3-thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102288220) has the molecular formula C32H25N3O5S2 and a molecular weight of 595.70 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-methoxy-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1,3-thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-methoxy-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1,3-thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102288220 |
| Molecular Formula | C32H25N3O5S2 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-methoxy-5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1,3-thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3sc(-c4ccc(/C=C(\C#N)C(=O)O)s4)nc3OC)cc2)cc1 |
| InChI | InChI=1S/C32H25N3O5S2/c1-38-25-12-8-23(9-13-25)35(24-10-14-26(39-2)15-11-24)22-6-4-20(5-7-22)29-30(40-3)34-31(42-29)28-17-16-27(41-28)18-21(19-33)32(36)37/h4-18H,1-3H3,(H,36,37)/b21-18+ |
| InChIKey | RBJGMAOLQCVDKQ-DYTRJAOYSA-N |
| XLogP | 8.03 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|