C28H16N4O6S — CID 59765904
(E)-3-[4-[N-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4-[(E)-2-carboxy-2-isocyanoethenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 59765904) has the molecular formula C28H16N4O6S and a molecular weight of 536.53 g/mol. Its IUPAC name is (E)-3-[4-[N-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4-[(E)-2-carboxy-2-isocyanoethenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[N-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4-[(E)-2-carboxy-2-isocyanoethenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 59765904 |
| Molecular Formula | C28H16N4O6S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | (E)-3-[4-[N-[5-[(Z)-2-carboxy-2-cyanoethenyl]thiophen-2-yl]-4-[(E)-2-carboxy-2-isocyanoethenyl]anilino]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1ccc(N(c2ccc(/C=C(\C#N)C(=O)O)cc2)c2ccc(/C=C(/C#N)C(=O)O)s2)cc1)C(=O)O |
| InChI | InChI=1S/C28H16N4O6S/c1-31-24(28(37)38)13-18-4-8-22(9-5-18)32(25-11-10-23(39-25)14-20(16-30)27(35)36)21-6-2-17(3-7-21)12-19(15-29)26(33)34/h2-14H,(H,33,34)(H,35,36)(H,37,38)/b19-12+,20-14-,24-13+ |
| InChIKey | NTTDPZBHWYLCBL-PVDZETTFSA-N |
| XLogP | 5.55 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|