C30H18N4O2S2Se — CID 102398553
(E)-2-cyano-3-[5-[4-[5-(N-phenylanilino)thiophen-2-yl]-2,1,3-benzoselenadiazol-7-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102398553) has the molecular formula C30H18N4O2S2Se and a molecular weight of 609.59 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-[5-(N-phenylanilino)thiophen-2-yl]-2,1,3-benzoselenadiazol-7-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-[5-(N-phenylanilino)thiophen-2-yl]-2,1,3-benzoselenadiazol-7-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102398553 |
| Molecular Formula | C30H18N4O2S2Se |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 610.00 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-[5-(N-phenylanilino)thiophen-2-yl]-2,1,3-benzoselenadiazol-7-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)s3)c3n[se]nc23)s1)C(=O)O |
| InChI | InChI=1S/C30H18N4O2S2Se/c31-18-19(30(35)36)17-22-11-14-25(37-22)23-12-13-24(29-28(23)32-39-33-29)26-15-16-27(38-26)34(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-17H,(H,35,36)/b19-17+ |
| InChIKey | DKKRGHAIWWUVBA-HTXNQAPBSA-N |
| XLogP | 7.61 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|