C32H34BrN3O2S2 — CID 175059217
(E)-3-[5-[8-(5-bromothiophen-2-yl)-2,3-dihexylquinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid (PubChem CID 175059217) has the molecular formula C32H34BrN3O2S2 and a molecular weight of 636.68 g/mol. Its IUPAC name is (E)-3-[5-[8-(5-bromothiophen-2-yl)-2,3-dihexylquinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[5-[8-(5-bromothiophen-2-yl)-2,3-dihexylquinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 175059217 |
| Molecular Formula | C32H34BrN3O2S2 |
| Molecular Weight | 636.68 g/mol |
| Exact Mass | 635.13 |
| IUPAC Name | (E)-3-[5-[8-(5-bromothiophen-2-yl)-2,3-dihexylquinoxalin-5-yl]thiophen-2-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCc1nc2c(-c3ccc(Br)s3)ccc(-c3ccc(/C=C(\C#N)C(=O)O)s3)c2nc1CCCCCC |
| InChI | InChI=1S/C32H34BrN3O2S2/c1-3-5-7-9-11-25-26(12-10-8-6-4-2)36-31-24(28-17-18-29(33)40-28)15-14-23(30(31)35-25)27-16-13-22(39-27)19-21(20-34)32(37)38/h13-19H,3-12H2,1-2H3,(H,37,38)/b21-19+ |
| InChIKey | ZPHSILKTBDTBCM-XUTLUUPISA-N |
| XLogP | 10.09 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.68 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|