C26H30Br2N2S3 — CID 102456583
5,7-bis(5-bromothiophen-2-yl)-2,3-dihexylthieno[3,4-b]pyrazine (PubChem CID 102456583) has the molecular formula C26H30Br2N2S3 and a molecular weight of 626.55 g/mol. Its IUPAC name is 5,7-bis(5-bromothiophen-2-yl)-2,3-dihexylthieno[3,4-b]pyrazine.
| Compound Name | 5,7-bis(5-bromothiophen-2-yl)-2,3-dihexylthieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 102456583 |
| Molecular Formula | C26H30Br2N2S3 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 623.99 |
| IUPAC Name | 5,7-bis(5-bromothiophen-2-yl)-2,3-dihexylthieno[3,4-b]pyrazine |
| SMILES | CCCCCCc1nc2c(-c3ccc(Br)s3)sc(-c3ccc(Br)s3)c2nc1CCCCCC |
| InChI | InChI=1S/C26H30Br2N2S3/c1-3-5-7-9-11-17-18(12-10-8-6-4-2)30-24-23(29-17)25(19-13-15-21(27)31-19)33-26(24)20-14-16-22(28)32-20/h13-16H,3-12H2,1-2H3 |
| InChIKey | OSFXEMWSEBFFQV-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|