C19H19Br3S3 — CID 86053610
2-[1,1-bis(5-bromothiophen-2-yl)heptyl]-5-bromothiophene (PubChem CID 86053610) has the molecular formula C19H19Br3S3 and a molecular weight of 583.27 g/mol. Its IUPAC name is 2-[1,1-bis(5-bromothiophen-2-yl)heptyl]-5-bromothiophene.
| Compound Name | 2-[1,1-bis(5-bromothiophen-2-yl)heptyl]-5-bromothiophene |
|---|---|
| PubChem CID | 86053610 |
| Molecular Formula | C19H19Br3S3 |
| Molecular Weight | 583.27 g/mol |
| Exact Mass | 579.82 |
| IUPAC Name | 2-[1,1-bis(5-bromothiophen-2-yl)heptyl]-5-bromothiophene |
| SMILES | CCCCCCC(c1ccc(Br)s1)(c1ccc(Br)s1)c1ccc(Br)s1 |
| InChI | InChI=1S/C19H19Br3S3/c1-2-3-4-5-12-19(13-6-9-16(20)23-13,14-7-10-17(21)24-14)15-8-11-18(22)25-15/h6-11H,2-5,12H2,1H3 |
| InChIKey | RTAJATQQWCSQEQ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.27 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|