C32H42Br2N2S4 — CID 102054987
5-(5-bromothiophen-2-yl)-2-[5-(5-bromothiophen-2-yl)-4-nonyl-1,3-thiazol-2-yl]-4-nonyl-1,3-thiazole (PubChem CID 102054987) has the molecular formula C32H42Br2N2S4 and a molecular weight of 742.78 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)-2-[5-(5-bromothiophen-2-yl)-4-nonyl-1,3-thiazol-2-yl]-4-nonyl-1,3-thiazole.
| Compound Name | 5-(5-bromothiophen-2-yl)-2-[5-(5-bromothiophen-2-yl)-4-nonyl-1,3-thiazol-2-yl]-4-nonyl-1,3-thiazole |
|---|---|
| PubChem CID | 102054987 |
| Molecular Formula | C32H42Br2N2S4 |
| Molecular Weight | 742.78 g/mol |
| Exact Mass | 740.06 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)-2-[5-(5-bromothiophen-2-yl)-4-nonyl-1,3-thiazol-2-yl]-4-nonyl-1,3-thiazole |
| SMILES | CCCCCCCCCc1nc(-c2nc(CCCCCCCCC)c(-c3ccc(Br)s3)s2)sc1-c1ccc(Br)s1 |
| InChI | InChI=1S/C32H42Br2N2S4/c1-3-5-7-9-11-13-15-17-23-29(25-19-21-27(33)37-25)39-31(35-23)32-36-24(18-16-14-12-10-8-6-4-2)30(40-32)26-20-22-28(34)38-26/h19-22H,3-18H2,1-2H3 |
| InChIKey | KTTCROOLQVUOGO-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.78 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|