C30H34N2S5 — CID 59297189
4-hexyl-2-[5-(4-hexyl-2-thiophen-2-yl-1,3-thiazol-5-yl)thiophen-2-yl]-5-thiophen-2-yl-1,3-thiazole (PubChem CID 59297189) has the molecular formula C30H34N2S5 and a molecular weight of 582.95 g/mol. Its IUPAC name is 4-hexyl-2-[5-(4-hexyl-2-thiophen-2-yl-1,3-thiazol-5-yl)thiophen-2-yl]-5-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-hexyl-2-[5-(4-hexyl-2-thiophen-2-yl-1,3-thiazol-5-yl)thiophen-2-yl]-5-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 59297189 |
| Molecular Formula | C30H34N2S5 |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 4-hexyl-2-[5-(4-hexyl-2-thiophen-2-yl-1,3-thiazol-5-yl)thiophen-2-yl]-5-thiophen-2-yl-1,3-thiazole |
| SMILES | CCCCCCc1nc(-c2ccc(-c3sc(-c4cccs4)nc3CCCCCC)s2)sc1-c1cccs1 |
| InChI | InChI=1S/C30H34N2S5/c1-3-5-7-9-13-21-27(23-15-11-19-33-23)36-30(32-21)26-18-17-24(35-26)28-22(14-10-8-6-4-2)31-29(37-28)25-16-12-20-34-25/h11-12,15-20H,3-10,13-14H2,1-2H3 |
| InChIKey | IKYPXSGLSITYSK-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|