C38H38N8S8 — CID 59297179
4-heptyl-2-[2-[5-[4-heptyl-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole (PubChem CID 59297179) has the molecular formula C38H38N8S8 and a molecular weight of 863.31 g/mol. Its IUPAC name is 4-heptyl-2-[2-[5-[4-heptyl-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole.
| Compound Name | 4-heptyl-2-[2-[5-[4-heptyl-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 59297179 |
| Molecular Formula | C38H38N8S8 |
| Molecular Weight | 863.31 g/mol |
| Exact Mass | 862.10 |
| IUPAC Name | 4-heptyl-2-[2-[5-[4-heptyl-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-5-[5-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]-1,3-thiazole |
| SMILES | CCCCCCCc1nc(-c2cnc(-c3ncc(-c4nc(CCCCCCC)c(-c5ncc(-c6nccs6)s5)s4)s3)s2)sc1-c1ncc(-c2nccs2)s1 |
| InChI | InChI=1S/C38H38N8S8/c1-3-5-7-9-11-13-23-29(35-41-19-25(49-35)31-39-15-17-47-31)53-33(45-23)27-21-43-37(51-27)38-44-22-28(52-38)34-46-24(14-12-10-8-6-4-2)30(54-34)36-42-20-26(50-36)32-40-16-18-48-32/h15-22H,3-14H2,1-2H3 |
| InChIKey | BCRSNUXINGEFHL-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.31 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|