C16H18N2S — CID 12066004
2-(2-pentyl-1H-indol-3-yl)-1,3-thiazole (PubChem CID 12066004) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(2-pentyl-1H-indol-3-yl)-1,3-thiazole.
| Compound Name | 2-(2-pentyl-1H-indol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 12066004 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(2-pentyl-1H-indol-3-yl)-1,3-thiazole |
| SMILES | CCCCCc1[nH]c2ccccc2c1-c1nccs1 |
| InChI | InChI=1S/C16H18N2S/c1-2-3-4-9-14-15(16-17-10-11-19-16)12-7-5-6-8-13(12)18-14/h5-8,10-11,18H,2-4,9H2,1H3 |
| InChIKey | REEKMQWMRDNDHP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|