C14H18N2S — CID 67464970
7-azabicyclo[2.2.1]hepta-1,3,5-triene;2-pentyl-1,3-thiazole (PubChem CID 67464970) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 7-azabicyclo[2.2.1]hepta-1,3,5-triene;2-pentyl-1,3-thiazole.
| Compound Name | 7-azabicyclo[2.2.1]hepta-1,3,5-triene;2-pentyl-1,3-thiazole |
|---|---|
| PubChem CID | 67464970 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 7-azabicyclo[2.2.1]hepta-1,3,5-triene;2-pentyl-1,3-thiazole |
| SMILES | CCCCCc1nccs1.c1cc2ccc1[nH]2 |
| InChI | InChI=1S/C8H13NS.C6H5N/c1-2-3-4-5-8-9-6-7-10-8;1-2-6-4-3-5(1)7-6/h6-7H,2-5H2,1H3;1-4,7H |
| InChIKey | FHRZHKXBKJBCLE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|