C8H13NOS — CID 79824086
5-(1,3-thiazol-2-yl)pentan-2-ol (PubChem CID 79824086) has the molecular formula C8H13NOS and a molecular weight of 171.27 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)pentan-2-ol.
| Compound Name | 5-(1,3-thiazol-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 79824086 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)pentan-2-ol |
| SMILES | CC(O)CCCc1nccs1 |
| InChI | InChI=1S/C8H13NOS/c1-7(10)3-2-4-8-9-5-6-11-8/h5-7,10H,2-4H2,1H3 |
| InChIKey | VLKFUPUFVFYNOG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |