C9H13NOS — CID 134309859
6-(1,3-thiazol-2-yl)hexan-2-one (PubChem CID 134309859) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-yl)hexan-2-one.
| Compound Name | 6-(1,3-thiazol-2-yl)hexan-2-one |
|---|---|
| PubChem CID | 134309859 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 6-(1,3-thiazol-2-yl)hexan-2-one |
| SMILES | CC(=O)CCCCc1nccs1 |
| InChI | InChI=1S/C9H13NOS/c1-8(11)4-2-3-5-9-10-6-7-12-9/h6-7H,2-5H2,1H3 |
| InChIKey | SPNBRLPQDSBYOG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|