C10H15BrN2OS — CID 107910060
5-bromo-N-[2-(1,3-thiazol-2-yl)ethyl]pentanamide (PubChem CID 107910060) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 5-bromo-N-[2-(1,3-thiazol-2-yl)ethyl]pentanamide.
| Compound Name | 5-bromo-N-[2-(1,3-thiazol-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 107910060 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-bromo-N-[2-(1,3-thiazol-2-yl)ethyl]pentanamide |
| SMILES | O=C(CCCCBr)NCCc1nccs1 |
| InChI | InChI=1S/C10H15BrN2OS/c11-5-2-1-3-9(14)12-6-4-10-13-7-8-15-10/h7-8H,1-6H2,(H,12,14) |
| InChIKey | NKPLSCGABXWDSS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|