C11H16N2O3S — CID 119235090
5-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid (PubChem CID 119235090) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid.
| Compound Name | 5-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119235090 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-[3-(1,3-thiazol-2-yl)propanoylamino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)CCc1nccs1 |
| InChI | InChI=1S/C11H16N2O3S/c14-9(4-5-10-13-7-8-17-10)12-6-2-1-3-11(15)16/h7-8H,1-6H2,(H,12,14)(H,15,16) |
| InChIKey | BAHSQSJZLABZMM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|