C15H25N3OS — CID 126452069
(4R)-4-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)propyl]pentanamide (PubChem CID 126452069) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is (4R)-4-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)propyl]pentanamide.
| Compound Name | (4R)-4-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 126452069 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (4R)-4-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)propyl]pentanamide |
| SMILES | C[C@H](CCC(=O)NCCCc1nccs1)N1CCCC1 |
| InChI | InChI=1S/C15H25N3OS/c1-13(18-10-2-3-11-18)6-7-14(19)16-8-4-5-15-17-9-12-20-15/h9,12-13H,2-8,10-11H2,1H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | MXJYIUDNXZGBRZ-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|