C15H27N5O — CID 125441014
(4R)-4-(4-methylpiperazin-1-yl)-N-[2-(1H-pyrazol-5-yl)ethyl]pentanamide (PubChem CID 125441014) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is (4R)-4-(4-methylpiperazin-1-yl)-N-[2-(1H-pyrazol-5-yl)ethyl]pentanamide.
| Compound Name | (4R)-4-(4-methylpiperazin-1-yl)-N-[2-(1H-pyrazol-5-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 125441014 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (4R)-4-(4-methylpiperazin-1-yl)-N-[2-(1H-pyrazol-5-yl)ethyl]pentanamide |
| SMILES | C[C@H](CCC(=O)NCCc1ccn[nH]1)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H27N5O/c1-13(20-11-9-19(2)10-12-20)3-4-15(21)16-7-5-14-6-8-17-18-14/h6,8,13H,3-5,7,9-12H2,1-2H3,(H,16,21)(H,17,18)/t13-/m1/s1 |
| InChIKey | BJWVSNJTYHZNOB-CYBMUJFWSA-N |
| XLogP | 0.48 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |