C17H24N4O2 — CID 125448711
5-[(1R)-1-piperidin-1-ylethyl]-N-[2-(1H-pyrazol-5-yl)ethyl]furan-2-carboxamide (PubChem CID 125448711) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 5-[(1R)-1-piperidin-1-ylethyl]-N-[2-(1H-pyrazol-5-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(1R)-1-piperidin-1-ylethyl]-N-[2-(1H-pyrazol-5-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 125448711 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 5-[(1R)-1-piperidin-1-ylethyl]-N-[2-(1H-pyrazol-5-yl)ethyl]furan-2-carboxamide |
| SMILES | C[C@H](c1ccc(C(=O)NCCc2ccn[nH]2)o1)N1CCCCC1 |
| InChI | InChI=1S/C17H24N4O2/c1-13(21-11-3-2-4-12-21)15-5-6-16(23-15)17(22)18-9-7-14-8-10-19-20-14/h5-6,8,10,13H,2-4,7,9,11-12H2,1H3,(H,18,22)(H,19,20)/t13-/m1/s1 |
| InChIKey | VGGOBJMUJJKSDT-CYBMUJFWSA-N |
| XLogP | 2.52 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |