C18H32N4OS — CID 91833958
N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-4-(4-methylpiperazin-1-yl)pentanamide (PubChem CID 91833958) has the molecular formula C18H32N4OS and a molecular weight of 352.55 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-4-(4-methylpiperazin-1-yl)pentanamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-4-(4-methylpiperazin-1-yl)pentanamide |
|---|---|
| PubChem CID | 91833958 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-4-(4-methylpiperazin-1-yl)pentanamide |
| SMILES | Cc1nc(CCCNC(=O)CCC(C)N2CCN(C)CC2)sc1C |
| InChI | InChI=1S/C18H32N4OS/c1-14(22-12-10-21(4)11-13-22)7-8-17(23)19-9-5-6-18-20-15(2)16(3)24-18/h14H,5-13H2,1-4H3,(H,19,23) |
| InChIKey | ULCMSXWBKWDNFX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|