C13H22N2O2S — CID 119061685
N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-ethoxypropanamide (PubChem CID 119061685) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-ethoxypropanamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-ethoxypropanamide |
|---|---|
| PubChem CID | 119061685 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-ethoxypropanamide |
| SMILES | CCOC(C)C(=O)NCCCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C13H22N2O2S/c1-5-17-10(3)13(16)14-8-6-7-12-15-9(2)11(4)18-12/h10H,5-8H2,1-4H3,(H,14,16) |
| InChIKey | RZJVDLROECXRIZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|