C11H18N2O3S — CID 90649803
N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 90649803) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 90649803 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C11H18N2O3S/c1-8-9(2)17-11(13-8)6-12-10(14)7-16-5-4-15-3/h4-7H2,1-3H3,(H,12,14) |
| InChIKey | LZXAQVUKOBAGRP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|