C17H30N4OS — CID 118795070
N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-3-[methyl-(1-methylpyrrolidin-3-yl)amino]propanamide (PubChem CID 118795070) has the molecular formula C17H30N4OS and a molecular weight of 338.52 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-3-[methyl-(1-methylpyrrolidin-3-yl)amino]propanamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-3-[methyl-(1-methylpyrrolidin-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 118795070 |
| Molecular Formula | C17H30N4OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-3-[methyl-(1-methylpyrrolidin-3-yl)amino]propanamide |
| SMILES | Cc1nc(CCCNC(=O)CCN(C)C2CCN(C)C2)sc1C |
| InChI | InChI=1S/C17H30N4OS/c1-13-14(2)23-17(19-13)6-5-9-18-16(22)8-11-21(4)15-7-10-20(3)12-15/h15H,5-12H2,1-4H3,(H,18,22) |
| InChIKey | YZTFILAOEBGMGY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|