C17H29N3OS — CID 72873347
N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1-propan-2-ylpiperidine-3-carboxamide (PubChem CID 72873347) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1-propan-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1-propan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 72873347 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1-propan-2-ylpiperidine-3-carboxamide |
| SMILES | Cc1nc(CCCNC(=O)C2CCCN(C(C)C)C2)sc1C |
| InChI | InChI=1S/C17H29N3OS/c1-12(2)20-10-6-7-15(11-20)17(21)18-9-5-8-16-19-13(3)14(4)22-16/h12,15H,5-11H2,1-4H3,(H,18,21) |
| InChIKey | ZDKDFIRDUOVSHM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|