C14H24N4OS — CID 125129943
(2R)-2-(4-methylpiperazin-1-yl)-N-[3-(1,3-thiazol-2-yl)propyl]propanamide (PubChem CID 125129943) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is (2R)-2-(4-methylpiperazin-1-yl)-N-[3-(1,3-thiazol-2-yl)propyl]propanamide.
| Compound Name | (2R)-2-(4-methylpiperazin-1-yl)-N-[3-(1,3-thiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 125129943 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (2R)-2-(4-methylpiperazin-1-yl)-N-[3-(1,3-thiazol-2-yl)propyl]propanamide |
| SMILES | C[C@H](C(=O)NCCCc1nccs1)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H24N4OS/c1-12(18-9-7-17(2)8-10-18)14(19)16-5-3-4-13-15-6-11-20-13/h6,11-12H,3-5,7-10H2,1-2H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | OZGNOJWDNZNBKC-GFCCVEGCSA-N |
| XLogP | 0.83 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|