C12H19N3OS — CID 63240285
2-piperidin-4-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 63240285) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-piperidin-4-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-piperidin-4-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 63240285 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-piperidin-4-yl-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | O=C(CC1CCNCC1)NCCc1nccs1 |
| InChI | InChI=1S/C12H19N3OS/c16-11(9-10-1-4-13-5-2-10)14-6-3-12-15-7-8-17-12/h7-8,10,13H,1-6,9H2,(H,14,16) |
| InChIKey | UVUQGCWFMSKJKE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |