C18H25Cl2N3O — CID 119840582
2-piperidin-4-yl-N-(2-quinolin-8-ylethyl)acetamide;dihydrochloride (PubChem CID 119840582) has the molecular formula C18H25Cl2N3O and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-piperidin-4-yl-N-(2-quinolin-8-ylethyl)acetamide;dihydrochloride.
| Compound Name | 2-piperidin-4-yl-N-(2-quinolin-8-ylethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119840582 |
| Molecular Formula | C18H25Cl2N3O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-piperidin-4-yl-N-(2-quinolin-8-ylethyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCNCC1)NCCc1cccc2cccnc12 |
| InChI | InChI=1S/C18H23N3O.2ClH/c22-17(13-14-6-10-19-11-7-14)20-12-8-16-4-1-3-15-5-2-9-21-18(15)16;;/h1-5,9,14,19H,6-8,10-13H2,(H,20,22);2*1H |
| InChIKey | IRRXSNDTLBKVLL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |