C19H34ClNO2S — CID 173396802
2-[6-(5-hexyloxolan-2-yl)oxyhexyl]-1,3-thiazole;hydrochloride (PubChem CID 173396802) has the molecular formula C19H34ClNO2S and a molecular weight of 376.01 g/mol. Its IUPAC name is 2-[6-(5-hexyloxolan-2-yl)oxyhexyl]-1,3-thiazole;hydrochloride.
| Compound Name | 2-[6-(5-hexyloxolan-2-yl)oxyhexyl]-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 173396802 |
| Molecular Formula | C19H34ClNO2S |
| Molecular Weight | 376.01 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-[6-(5-hexyloxolan-2-yl)oxyhexyl]-1,3-thiazole;hydrochloride |
| SMILES | CCCCCCC1CCC(OCCCCCCc2nccs2)O1.Cl |
| InChI | InChI=1S/C19H33NO2S.ClH/c1-2-3-4-7-10-17-12-13-19(22-17)21-15-9-6-5-8-11-18-20-14-16-23-18;/h14,16-17,19H,2-13,15H2,1H3;1H |
| InChIKey | OKWMGKYTSSPOJR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.01 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|