C27H40NO2+ — CID 19835756
1-[6-(5-hexyloxolan-2-yl)oxyhexyl]-4-phenylpyridin-1-ium (PubChem CID 19835756) has the molecular formula C27H40NO2+ and a molecular weight of 410.62 g/mol. Its IUPAC name is 1-[6-(5-hexyloxolan-2-yl)oxyhexyl]-4-phenylpyridin-1-ium.
| Compound Name | 1-[6-(5-hexyloxolan-2-yl)oxyhexyl]-4-phenylpyridin-1-ium |
|---|---|
| PubChem CID | 19835756 |
| Molecular Formula | C27H40NO2+ |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 1-[6-(5-hexyloxolan-2-yl)oxyhexyl]-4-phenylpyridin-1-ium |
| SMILES | CCCCCCC1CCC(OCCCCCC[n+]2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C27H40NO2/c1-2-3-4-10-15-26-16-17-27(30-26)29-23-12-6-5-11-20-28-21-18-25(19-22-28)24-13-8-7-9-14-24/h7-9,13-14,18-19,21-22,26-27H,2-6,10-12,15-17,20,23H2,1H3/q+1 |
| InChIKey | PHRASXPRBNGOOT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|